C10H21N3O3S — CID 113065279
1-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]-3-propan-2-ylurea (PubChem CID 113065279) has the molecular formula C10H21N3O3S and a molecular weight of 263.36 g/mol. Its IUPAC name is 1-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113065279 |
| Molecular Formula | C10H21N3O3S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 1-[2-[methylsulfonyl(prop-2-enyl)amino]ethyl]-3-propan-2-ylurea |
| SMILES | C=CCN(CCNC(=O)NC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C10H21N3O3S/c1-5-7-13(17(4,15)16)8-6-11-10(14)12-9(2)3/h5,9H,1,6-8H2,2-4H3,(H2,11,12,14) |
| InChIKey | XPQATMHNCYRNAE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|