C13H19F2N3O3S — CID 113072449
1-[2-(2,6-difluoro-N-methylsulfonylanilino)ethyl]-3-propan-2-ylurea (PubChem CID 113072449) has the molecular formula C13H19F2N3O3S and a molecular weight of 335.38 g/mol. Its IUPAC name is 1-[2-(2,6-difluoro-N-methylsulfonylanilino)ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-(2,6-difluoro-N-methylsulfonylanilino)ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113072449 |
| Molecular Formula | C13H19F2N3O3S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[2-(2,6-difluoro-N-methylsulfonylanilino)ethyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCN(c1c(F)cccc1F)S(C)(=O)=O |
| InChI | InChI=1S/C13H19F2N3O3S/c1-9(2)17-13(19)16-7-8-18(22(3,20)21)12-10(14)5-4-6-11(12)15/h4-6,9H,7-8H2,1-3H3,(H2,16,17,19) |
| InChIKey | GUNNXRYLSRTRHJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |