C16H25N3O5S — CID 113072144
ethyl 2-[methylsulfonyl-[2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate (PubChem CID 113072144) has the molecular formula C16H25N3O5S and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl 2-[methylsulfonyl-[2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate.
| Compound Name | ethyl 2-[methylsulfonyl-[2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate |
|---|---|
| PubChem CID | 113072144 |
| Molecular Formula | C16H25N3O5S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl 2-[methylsulfonyl-[2-(propan-2-ylcarbamoylamino)ethyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1N(CCNC(=O)NC(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C16H25N3O5S/c1-5-24-15(20)13-8-6-7-9-14(13)19(25(4,22)23)11-10-17-16(21)18-12(2)3/h6-9,12H,5,10-11H2,1-4H3,(H2,17,18,21) |
| InChIKey | GQUBCFWIPPDQJN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |