C12H25N3O3S — CID 113065754
1-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-3-propan-2-ylurea (PubChem CID 113065754) has the molecular formula C12H25N3O3S and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-3-propan-2-ylurea.
| Compound Name | 1-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-3-propan-2-ylurea |
|---|---|
| PubChem CID | 113065754 |
| Molecular Formula | C12H25N3O3S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 1-[2-[cyclopentyl(methylsulfonyl)amino]ethyl]-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NCCN(C1CCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C12H25N3O3S/c1-10(2)14-12(16)13-8-9-15(19(3,17)18)11-6-4-5-7-11/h10-11H,4-9H2,1-3H3,(H2,13,14,16) |
| InChIKey | LPZYRFRZGUEJJU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |