C15H30N2O3S — CID 113068122
N-[2-[cycloheptyl(methylsulfonyl)amino]ethyl]pentanamide (PubChem CID 113068122) has the molecular formula C15H30N2O3S and a molecular weight of 318.48 g/mol. Its IUPAC name is N-[2-[cycloheptyl(methylsulfonyl)amino]ethyl]pentanamide.
| Compound Name | N-[2-[cycloheptyl(methylsulfonyl)amino]ethyl]pentanamide |
|---|---|
| PubChem CID | 113068122 |
| Molecular Formula | C15H30N2O3S |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | N-[2-[cycloheptyl(methylsulfonyl)amino]ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCN(C1CCCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H30N2O3S/c1-3-4-11-15(18)16-12-13-17(21(2,19)20)14-9-7-5-6-8-10-14/h14H,3-13H2,1-2H3,(H,16,18) |
| InChIKey | RYJAEPAFBGOSHC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |