C14H28N2O3S — CID 113137366
N-butyl-3-[cyclohexyl(methylsulfonyl)amino]propanamide (PubChem CID 113137366) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is N-butyl-3-[cyclohexyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-butyl-3-[cyclohexyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113137366 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-butyl-3-[cyclohexyl(methylsulfonyl)amino]propanamide |
| SMILES | CCCCNC(=O)CCN(C1CCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C14H28N2O3S/c1-3-4-11-15-14(17)10-12-16(20(2,18)19)13-8-6-5-7-9-13/h13H,3-12H2,1-2H3,(H,15,17) |
| InChIKey | PLAOXMAQTDBXEU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|