C16H32N2O3S — CID 113141017
3-[cycloheptyl(methylsulfonyl)amino]-N-pentylpropanamide (PubChem CID 113141017) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is 3-[cycloheptyl(methylsulfonyl)amino]-N-pentylpropanamide.
| Compound Name | 3-[cycloheptyl(methylsulfonyl)amino]-N-pentylpropanamide |
|---|---|
| PubChem CID | 113141017 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 3-[cycloheptyl(methylsulfonyl)amino]-N-pentylpropanamide |
| SMILES | CCCCCNC(=O)CCN(C1CCCCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C16H32N2O3S/c1-3-4-9-13-17-16(19)12-14-18(22(2,20)21)15-10-7-5-6-8-11-15/h15H,3-14H2,1-2H3,(H,17,19) |
| InChIKey | JGVMAFUDIDOFEM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|