C12H24N2O5S — CID 126693594
tert-butyl N-[(2S)-2-hydroxy-3-[methylsulfonyl(prop-2-enyl)amino]propyl]carbamate (PubChem CID 126693594) has the molecular formula C12H24N2O5S and a molecular weight of 308.40 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-hydroxy-3-[methylsulfonyl(prop-2-enyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-hydroxy-3-[methylsulfonyl(prop-2-enyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 126693594 |
| Molecular Formula | C12H24N2O5S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | tert-butyl N-[(2S)-2-hydroxy-3-[methylsulfonyl(prop-2-enyl)amino]propyl]carbamate |
| SMILES | C=CCN(C[C@@H](O)CNC(=O)OC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C12H24N2O5S/c1-6-7-14(20(5,17)18)9-10(15)8-13-11(16)19-12(2,3)4/h6,10,15H,1,7-9H2,2-5H3,(H,13,16)/t10-/m0/s1 |
| InChIKey | HTKLNUCAMWNEGZ-JTQLQIEISA-N |
| XLogP | 0.32 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|