C13H25N3O5S — CID 126819328
tert-butyl N-[3-[3-cyanopropylsulfonyl(methyl)amino]-2-hydroxypropyl]carbamate (PubChem CID 126819328) has the molecular formula C13H25N3O5S and a molecular weight of 335.43 g/mol. Its IUPAC name is tert-butyl N-[3-[3-cyanopropylsulfonyl(methyl)amino]-2-hydroxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-cyanopropylsulfonyl(methyl)amino]-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 126819328 |
| Molecular Formula | C13H25N3O5S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | tert-butyl N-[3-[3-cyanopropylsulfonyl(methyl)amino]-2-hydroxypropyl]carbamate |
| SMILES | CN(CC(O)CNC(=O)OC(C)(C)C)S(=O)(=O)CCCC#N |
| InChI | InChI=1S/C13H25N3O5S/c1-13(2,3)21-12(18)15-9-11(17)10-16(4)22(19,20)8-6-5-7-14/h11,17H,5-6,8-10H2,1-4H3,(H,15,18) |
| InChIKey | KYCUDTFRWCKRBI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|