C15H31N3O4S — CID 136573574
tert-butyl N-[3-[methyl(2-pyrrolidin-1-ylethyl)sulfamoyl]propyl]carbamate (PubChem CID 136573574) has the molecular formula C15H31N3O4S and a molecular weight of 349.50 g/mol. Its IUPAC name is tert-butyl N-[3-[methyl(2-pyrrolidin-1-ylethyl)sulfamoyl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[methyl(2-pyrrolidin-1-ylethyl)sulfamoyl]propyl]carbamate |
|---|---|
| PubChem CID | 136573574 |
| Molecular Formula | C15H31N3O4S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | tert-butyl N-[3-[methyl(2-pyrrolidin-1-ylethyl)sulfamoyl]propyl]carbamate |
| SMILES | CN(CCN1CCCC1)S(=O)(=O)CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H31N3O4S/c1-15(2,3)22-14(19)16-8-7-13-23(20,21)17(4)11-12-18-9-5-6-10-18/h5-13H2,1-4H3,(H,16,19) |
| InChIKey | KNAZTKOUBPUGOE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|