C13H19BrN2O4S — CID 113065961
4-bromo-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]benzamide (PubChem CID 113065961) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is 4-bromo-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]benzamide.
| Compound Name | 4-bromo-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 113065961 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 4-bromo-N-[2-[2-methoxyethyl(methylsulfonyl)amino]ethyl]benzamide |
| SMILES | COCCN(CCNC(=O)c1ccc(Br)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C13H19BrN2O4S/c1-20-10-9-16(21(2,18)19)8-7-15-13(17)11-3-5-12(14)6-4-11/h3-6H,7-10H2,1-2H3,(H,15,17) |
| InChIKey | JEVNHKKKZRJWEA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |