C19H33N3O3S — CID 113066394
4-tert-butyl-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzamide (PubChem CID 113066394) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 113066394 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-tert-butyl-N-[2-[3-(dimethylamino)propyl-methylsulfonylamino]ethyl]benzamide |
| SMILES | CN(C)CCCN(CCNC(=O)c1ccc(C(C)(C)C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C19H33N3O3S/c1-19(2,3)17-10-8-16(9-11-17)18(23)20-12-15-22(26(6,24)25)14-7-13-21(4)5/h8-11H,7,12-15H2,1-6H3,(H,20,23) |
| InChIKey | BGXZDAMNAMTKEC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |