C11H25N3O4S — CID 113137638
N-[2-(dimethylamino)ethyl]-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide (PubChem CID 113137638) has the molecular formula C11H25N3O4S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 113137638 |
| Molecular Formula | C11H25N3O4S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[2-methoxyethyl(methylsulfonyl)amino]propanamide |
| SMILES | COCCN(CCC(=O)NCCN(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C11H25N3O4S/c1-13(2)8-6-12-11(15)5-7-14(9-10-18-3)19(4,16)17/h5-10H2,1-4H3,(H,12,15) |
| InChIKey | XCUWWFMAVRMKTA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |