C13H29N3O3S — CID 113066227
N-[2-[2-(dimethylamino)ethyl-methylsulfonylamino]ethyl]-2-ethylbutanamide (PubChem CID 113066227) has the molecular formula C13H29N3O3S and a molecular weight of 307.46 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethyl-methylsulfonylamino]ethyl]-2-ethylbutanamide.
| Compound Name | N-[2-[2-(dimethylamino)ethyl-methylsulfonylamino]ethyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113066227 |
| Molecular Formula | C13H29N3O3S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethyl-methylsulfonylamino]ethyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)NCCN(CCN(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C13H29N3O3S/c1-6-12(7-2)13(17)14-8-9-16(20(5,18)19)11-10-15(3)4/h12H,6-11H2,1-5H3,(H,14,17) |
| InChIKey | CCILDMYEWLRDKP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |