C14H30N2O2 — CID 154679925
N-[2-(dimethylamino)ethyl]-2-ethyl-4-oxohexanamide;ethane (PubChem CID 154679925) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-ethyl-4-oxohexanamide;ethane.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-ethyl-4-oxohexanamide;ethane |
|---|---|
| PubChem CID | 154679925 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-ethyl-4-oxohexanamide;ethane |
| SMILES | CC.CCC(=O)CC(CC)C(=O)NCCN(C)C |
| InChI | InChI=1S/C12H24N2O2.C2H6/c1-5-10(9-11(15)6-2)12(16)13-7-8-14(3)4;1-2/h10H,5-9H2,1-4H3,(H,13,16);1-2H3 |
| InChIKey | AYYYNAYLCFXXFQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |