C47H89N9O8 — CID 167701707
2-N,13-N-dibutyl-9-[2-(butylamino)-2-oxoethyl]-1-N,6-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-4,8,11-trioxopentadecane-1,2,6,13-tetracarboxamide (PubChem CID 167701707) has the molecular formula C47H89N9O8 and a molecular weight of 908.28 g/mol. Its IUPAC name is 2-N,13-N-dibutyl-9-[2-(butylamino)-2-oxoethyl]-1-N,6-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-4,8,11-trioxopentadecane-1,2,6,13-tetracarboxamide.
| Compound Name | 2-N,13-N-dibutyl-9-[2-(butylamino)-2-oxoethyl]-1-N,6-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-4,8,11-trioxopentadecane-1,2,6,13-tetracarboxamide |
|---|---|
| PubChem CID | 167701707 |
| Molecular Formula | C47H89N9O8 |
| Molecular Weight | 908.28 g/mol |
| Exact Mass | 907.68 |
| IUPAC Name | 2-N,13-N-dibutyl-9-[2-(butylamino)-2-oxoethyl]-1-N,6-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-4,8,11-trioxopentadecane-1,2,6,13-tetracarboxamide |
| SMILES | CCCCNC(=O)CC(CC(=O)CC(CC)C(=O)NCCCC)C(=O)CC(CC(=O)CC(CC(=O)NCCN(C)CCN(C)C)C(=O)NCCCC)C(=O)NCCN(C)CCN(C)C |
| InChI | InChI=1S/C47H89N9O8/c1-11-15-18-48-43(60)34-37(30-40(57)29-36(14-4)45(62)50-19-16-12-2)42(59)33-38(46(63)52-22-24-56(10)28-26-54(7)8)31-41(58)32-39(47(64)51-20-17-13-3)35-44(61)49-21-23-55(9)27-25-53(5)6/h36-39H,11-35H2,1-10H3,(H,48,60)(H,49,61)(H,50,62)(H,51,64)(H,52,63) |
| InChIKey | QUDYWNXPBRDGAK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 209.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|