C44H85N7O6 — CID 167561779
2-N-butyl-1-N,7-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-11-ethyl-4,4,9,9-tetramethyl-5,10,13-trioxoheptadecane-1,2,7-tricarboxamide (PubChem CID 167561779) has the molecular formula C44H85N7O6 and a molecular weight of 808.21 g/mol. Its IUPAC name is 2-N-butyl-1-N,7-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-11-ethyl-4,4,9,9-tetramethyl-5,10,13-trioxoheptadecane-1,2,7-tricarboxamide.
| Compound Name | 2-N-butyl-1-N,7-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-11-ethyl-4,4,9,9-tetramethyl-5,10,13-trioxoheptadecane-1,2,7-tricarboxamide |
|---|---|
| PubChem CID | 167561779 |
| Molecular Formula | C44H85N7O6 |
| Molecular Weight | 808.21 g/mol |
| Exact Mass | 807.66 |
| IUPAC Name | 2-N-butyl-1-N,7-N-bis[2-[2-(dimethylamino)ethyl-methylamino]ethyl]-11-ethyl-4,4,9,9-tetramethyl-5,10,13-trioxoheptadecane-1,2,7-tricarboxamide |
| SMILES | CCCCNC(=O)C(CC(=O)NCCN(C)CCN(C)C)CC(C)(C)C(=O)CC(CC(C)(C)C(=O)C(CC)CC(=O)CCCC)C(=O)NCCN(C)CCN(C)C |
| InChI | InChI=1S/C44H85N7O6/c1-14-17-19-37(52)29-34(16-3)40(55)44(6,7)33-35(41(56)47-22-24-51(13)28-26-49(10)11)30-38(53)43(4,5)32-36(42(57)46-20-18-15-2)31-39(54)45-21-23-50(12)27-25-48(8)9/h34-36H,14-33H2,1-13H3,(H,45,54)(H,46,57)(H,47,56) |
| InChIKey | SBWNUDBQALYMBB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 151.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.21 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|