C13H26N2 — CID 130219694
N-(3-ethyl-5-methylhexa-1,5-dien-2-yl)-N',N'-dimethylethane-1,2-diamine (PubChem CID 130219694) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is N-(3-ethyl-5-methylhexa-1,5-dien-2-yl)-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-(3-ethyl-5-methylhexa-1,5-dien-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 130219694 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N-(3-ethyl-5-methylhexa-1,5-dien-2-yl)-N',N'-dimethylethane-1,2-diamine |
| SMILES | C=C(C)CC(CC)C(=C)NCCN(C)C |
| InChI | InChI=1S/C13H26N2/c1-7-13(10-11(2)3)12(4)14-8-9-15(5)6/h13-14H,2,4,7-10H2,1,3,5-6H3 |
| InChIKey | GPPQFZJVIVFEEW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|