C16H33N3O3 — CID 145117042
2-[butanoyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-4-oxopentanamide;ethane (PubChem CID 145117042) has the molecular formula C16H33N3O3 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-[butanoyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-4-oxopentanamide;ethane.
| Compound Name | 2-[butanoyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-4-oxopentanamide;ethane |
|---|---|
| PubChem CID | 145117042 |
| Molecular Formula | C16H33N3O3 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.25 |
| IUPAC Name | 2-[butanoyl(methyl)amino]-N-[2-(dimethylamino)ethyl]-4-oxopentanamide;ethane |
| SMILES | CC.CCCC(=O)N(C)C(CC(C)=O)C(=O)NCCN(C)C |
| InChI | InChI=1S/C14H27N3O3.C2H6/c1-6-7-13(19)17(5)12(10-11(2)18)14(20)15-8-9-16(3)4;1-2/h12H,6-10H2,1-5H3,(H,15,20);1-2H3 |
| InChIKey | KWFUTVWWUTVCLJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |