C20H34N4O5S — CID 147189988
N-[1-[2-(dimethylamino)ethylamino]-1,4-dioxopentan-2-yl]-6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-methylhexanamide (PubChem CID 147189988) has the molecular formula C20H34N4O5S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[1-[2-(dimethylamino)ethylamino]-1,4-dioxopentan-2-yl]-6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-methylhexanamide.
| Compound Name | N-[1-[2-(dimethylamino)ethylamino]-1,4-dioxopentan-2-yl]-6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-methylhexanamide |
|---|---|
| PubChem CID | 147189988 |
| Molecular Formula | C20H34N4O5S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | N-[1-[2-(dimethylamino)ethylamino]-1,4-dioxopentan-2-yl]-6-(2,5-dioxopyrrolidin-3-yl)sulfanyl-N-methylhexanamide |
| SMILES | CC(=O)CC(C(=O)NCCN(C)C)N(C)C(=O)CCCCCSC1CC(=O)NC1=O |
| InChI | InChI=1S/C20H34N4O5S/c1-14(25)12-15(19(28)21-9-10-23(2)3)24(4)18(27)8-6-5-7-11-30-16-13-17(26)22-20(16)29/h15-16H,5-13H2,1-4H3,(H,21,28)(H,22,26,29) |
| InChIKey | CKGUBXDJCOICGM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|