C15H26N2O4 — CID 159896807
N-butyl-2-[methyl(4-oxopentanoyl)amino]-4-oxopentanamide (PubChem CID 159896807) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is N-butyl-2-[methyl(4-oxopentanoyl)amino]-4-oxopentanamide.
| Compound Name | N-butyl-2-[methyl(4-oxopentanoyl)amino]-4-oxopentanamide |
|---|---|
| PubChem CID | 159896807 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | N-butyl-2-[methyl(4-oxopentanoyl)amino]-4-oxopentanamide |
| SMILES | CCCCNC(=O)C(CC(C)=O)N(C)C(=O)CCC(C)=O |
| InChI | InChI=1S/C15H26N2O4/c1-5-6-9-16-15(21)13(10-12(3)19)17(4)14(20)8-7-11(2)18/h13H,5-10H2,1-4H3,(H,16,21) |
| InChIKey | IHOVIUTZQGFZCZ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|