C14H27N3O4S — CID 123487806
4-[2-(methylamino)ethylamino]-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxobutanoic acid (PubChem CID 123487806) has the molecular formula C14H27N3O4S and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-[2-(methylamino)ethylamino]-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-[2-(methylamino)ethylamino]-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 123487806 |
| Molecular Formula | C14H27N3O4S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-[2-(methylamino)ethylamino]-3-[methyl(6-sulfanylhexanoyl)amino]-4-oxobutanoic acid |
| SMILES | CNCCNC(=O)C(CC(=O)O)N(C)C(=O)CCCCCS |
| InChI | InChI=1S/C14H27N3O4S/c1-15-7-8-16-14(21)11(10-13(19)20)17(2)12(18)6-4-3-5-9-22/h11,15,22H,3-10H2,1-2H3,(H,16,21)(H,19,20) |
| InChIKey | JINRYZDZIFAWAU-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|