C18H35N3O3 — CID 137392136
2-[3,3-dimethylbutanoyl(methyl)amino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide (PubChem CID 137392136) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-[3,3-dimethylbutanoyl(methyl)amino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide.
| Compound Name | 2-[3,3-dimethylbutanoyl(methyl)amino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 137392136 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | 2-[3,3-dimethylbutanoyl(methyl)amino]-5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
| SMILES | CNCCNC(=O)C(CC(=O)C(C)(C)C)N(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C18H35N3O3/c1-17(2,3)12-15(23)21(8)13(11-14(22)18(4,5)6)16(24)20-10-9-19-7/h13,19H,9-12H2,1-8H3,(H,20,24) |
| InChIKey | FZMIYCCRHAZPOT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|