C17H34N2O3 — CID 140938920
(2S)-6-(tert-butylamino)-2-[3,3-dimethylbutanoyl(methyl)amino]hexanoic acid (PubChem CID 140938920) has the molecular formula C17H34N2O3 and a molecular weight of 314.47 g/mol. Its IUPAC name is (2S)-6-(tert-butylamino)-2-[3,3-dimethylbutanoyl(methyl)amino]hexanoic acid.
| Compound Name | (2S)-6-(tert-butylamino)-2-[3,3-dimethylbutanoyl(methyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 140938920 |
| Molecular Formula | C17H34N2O3 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | (2S)-6-(tert-butylamino)-2-[3,3-dimethylbutanoyl(methyl)amino]hexanoic acid |
| SMILES | CN(C(=O)CC(C)(C)C)[C@@H](CCCCNC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C17H34N2O3/c1-16(2,3)12-14(20)19(7)13(15(21)22)10-8-9-11-18-17(4,5)6/h13,18H,8-12H2,1-7H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | QFPSLNBZTCFKLW-ZDUSSCGKSA-N |
| XLogP | 2.89 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|