C13H23FmN2O5- — CID 166490318
fermium;2-[methyl(oxomethyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 166490318) has the molecular formula C13H23FmN2O5- and a molecular weight of 544.34 g/mol. Its IUPAC name is fermium;2-[methyl(oxomethyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | fermium;2-[methyl(oxomethyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 166490318 |
| Molecular Formula | C13H23FmN2O5- |
| Molecular Weight | 544.34 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | fermium;2-[methyl(oxomethyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CN([C-]=O)C(CCCCNC(=O)OC(C)(C)C)C(=O)O.[Fm] |
| InChI | InChI=1S/C13H23N2O5.Fm/c1-13(2,3)20-12(19)14-8-6-5-7-10(11(17)18)15(4)9-16;/h10H,5-8H2,1-4H3,(H,14,19)(H,17,18);/q-1; |
| InChIKey | IVSHQYXPKCDTNH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|