C16H29FmN2O5- — CID 170747974
tert-butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxomethylamino)hexanoate;fermium (PubChem CID 170747974) has the molecular formula C16H29FmN2O5- and a molecular weight of 586.42 g/mol. Its IUPAC name is tert-butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxomethylamino)hexanoate;fermium.
| Compound Name | tert-butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxomethylamino)hexanoate;fermium |
|---|---|
| PubChem CID | 170747974 |
| Molecular Formula | C16H29FmN2O5- |
| Molecular Weight | 586.42 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | tert-butyl 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxomethylamino)hexanoate;fermium |
| SMILES | CC(C)(C)OC(=O)NCCCCC(N[C-]=O)C(=O)OC(C)(C)C.[Fm] |
| InChI | InChI=1S/C16H29N2O5.Fm/c1-15(2,3)22-13(20)12(18-11-19)9-7-8-10-17-14(21)23-16(4,5)6;/h12H,7-10H2,1-6H3,(H,17,21)(H,18,19);/q-1; |
| InChIKey | VAOWHAFGTFQIHY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|