C19H36N4O4 — CID 164724803
tert-butyl (2S)-2-[2-(3-methyldiazirin-3-yl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 164724803) has the molecular formula C19H36N4O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl (2S)-2-[2-(3-methyldiazirin-3-yl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | tert-butyl (2S)-2-[2-(3-methyldiazirin-3-yl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 164724803 |
| Molecular Formula | C19H36N4O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | tert-butyl (2S)-2-[2-(3-methyldiazirin-3-yl)ethylamino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | CC1(CCN[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)N=N1 |
| InChI | InChI=1S/C19H36N4O4/c1-17(2,3)26-15(24)14(20-13-11-19(7)22-23-19)10-8-9-12-21-16(25)27-18(4,5)6/h14,20H,8-13H2,1-7H3,(H,21,25)/t14-/m0/s1 |
| InChIKey | GQYRXDBMNHQJSB-AWEZNQCLSA-N |
| XLogP | 3.55 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|