C14H23F3N2O5 — CID 163131254
(2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid (PubChem CID 163131254) has the molecular formula C14H23F3N2O5 and a molecular weight of 356.34 g/mol. Its IUPAC name is (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid.
| Compound Name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 163131254 |
| Molecular Formula | C14H23F3N2O5 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (2R)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2,2,2-trifluoroacetyl)amino]hexanoic acid |
| SMILES | CN(C(=O)OC(C)(C)C)[C@H](CCCCNC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C14H23F3N2O5/c1-13(2,3)24-12(23)19(4)9(10(20)21)7-5-6-8-18-11(22)14(15,16)17/h9H,5-8H2,1-4H3,(H,18,22)(H,20,21)/t9-/m1/s1 |
| InChIKey | GGCKKDDNIMDFDY-SECBINFHSA-N |
| XLogP | 2.16 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|