C18H34IN3O3 — CID 146233320
N-[2-(dimethylamino)ethyl]-2-[3,3-dimethylbutanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide (PubChem CID 146233320) has the molecular formula C18H34IN3O3 and a molecular weight of 467.39 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-[3,3-dimethylbutanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-[3,3-dimethylbutanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide |
|---|---|
| PubChem CID | 146233320 |
| Molecular Formula | C18H34IN3O3 |
| Molecular Weight | 467.39 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-[3,3-dimethylbutanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide |
| SMILES | CN(C)CCNC(=O)C(CC(=O)C(C)(C)I)N(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C18H34IN3O3/c1-17(2,3)12-15(24)22(8)13(11-14(23)18(4,5)19)16(25)20-9-10-21(6)7/h13H,9-12H2,1-8H3,(H,20,25) |
| InChIKey | NJBZXDDQSKIQQU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|