C17H32IN3O3 — CID 146233349
(2S)-N-[2-(dimethylamino)ethyl]-2-[2,2-dimethylpropanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide (PubChem CID 146233349) has the molecular formula C17H32IN3O3 and a molecular weight of 453.37 g/mol. Its IUPAC name is (2S)-N-[2-(dimethylamino)ethyl]-2-[2,2-dimethylpropanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide.
| Compound Name | (2S)-N-[2-(dimethylamino)ethyl]-2-[2,2-dimethylpropanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide |
|---|---|
| PubChem CID | 146233349 |
| Molecular Formula | C17H32IN3O3 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (2S)-N-[2-(dimethylamino)ethyl]-2-[2,2-dimethylpropanoyl(methyl)amino]-5-iodo-5-methyl-4-oxohexanamide |
| SMILES | CN(C)CCNC(=O)[C@H](CC(=O)C(C)(C)I)N(C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C17H32IN3O3/c1-16(2,3)15(24)21(8)12(11-13(22)17(4,5)18)14(23)19-9-10-20(6)7/h12H,9-11H2,1-8H3,(H,19,23)/t12-/m0/s1 |
| InChIKey | XAZZTRJPOAWPOA-LBPRGKRZSA-N |
| XLogP | 1.71 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|