C11H22N2O2 — CID 123850172
5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide (PubChem CID 123850172) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide.
| Compound Name | 5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
|---|---|
| PubChem CID | 123850172 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 5,5-dimethyl-N-[2-(methylamino)ethyl]-4-oxohexanamide |
| SMILES | CNCCNC(=O)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22N2O2/c1-11(2,3)9(14)5-6-10(15)13-8-7-12-4/h12H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | MVRPGLXHFWCFCP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|