C35H60N2O — CID 170133551
(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethyl-N-[2-(methylamino)ethyl]hexacosa-4,8,12,16,20,24-hexaenamide (PubChem CID 170133551) has the molecular formula C35H60N2O and a molecular weight of 524.88 g/mol. Its IUPAC name is (4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethyl-N-[2-(methylamino)ethyl]hexacosa-4,8,12,16,20,24-hexaenamide.
| Compound Name | (4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethyl-N-[2-(methylamino)ethyl]hexacosa-4,8,12,16,20,24-hexaenamide |
|---|---|
| PubChem CID | 170133551 |
| Molecular Formula | C35H60N2O |
| Molecular Weight | 524.88 g/mol |
| Exact Mass | 524.47 |
| IUPAC Name | (4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethyl-N-[2-(methylamino)ethyl]hexacosa-4,8,12,16,20,24-hexaenamide |
| SMILES | CNCCNC(=O)CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C35H60N2O/c1-29(2)15-11-18-32(5)21-12-19-30(3)16-9-10-17-31(4)20-13-22-33(6)23-14-24-34(7)25-26-35(38)37-28-27-36-8/h15-17,21-22,24,36H,9-14,18-20,23,25-28H2,1-8H3,(H,37,38)/b30-16+,31-17+,32-21+,33-22+,34-24+ |
| InChIKey | BGEFZCKCKRDXPP-HBEYJBAPSA-N |
| XLogP | 9.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.88 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|