C33H57N — CID 145283944
(4E,8E,12E,16E,20E)-N,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaen-1-amine (PubChem CID 145283944) has the molecular formula C33H57N and a molecular weight of 467.83 g/mol. Its IUPAC name is (4E,8E,12E,16E,20E)-N,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaen-1-amine.
| Compound Name | (4E,8E,12E,16E,20E)-N,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaen-1-amine |
|---|---|
| PubChem CID | 145283944 |
| Molecular Formula | C33H57N |
| Molecular Weight | 467.83 g/mol |
| Exact Mass | 467.45 |
| IUPAC Name | (4E,8E,12E,16E,20E)-N,4,8,12,17,21,25-heptamethylhexacosa-4,8,12,16,20,24-hexaen-1-amine |
| SMILES | CNCCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C33H57N/c1-28(2)16-11-19-31(5)22-12-20-29(3)17-9-10-18-30(4)21-13-23-32(6)24-14-25-33(7)26-15-27-34-8/h16-18,22-23,25,34H,9-15,19-21,24,26-27H2,1-8H3/b29-17+,30-18+,31-22+,32-23+,33-25+ |
| InChIKey | RZSWSSGVAHRDLG-LZRZEKPOSA-N |
| XLogP | 10.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.83 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|