C32H53Br — CID 162298741
26-bromo-2,6,10,15,19,23-hexamethylhexacosa-2,6,10,14,18,22-hexaene (PubChem CID 162298741) has the molecular formula C32H53Br and a molecular weight of 517.68 g/mol. Its IUPAC name is 26-bromo-2,6,10,15,19,23-hexamethylhexacosa-2,6,10,14,18,22-hexaene.
| Compound Name | 26-bromo-2,6,10,15,19,23-hexamethylhexacosa-2,6,10,14,18,22-hexaene |
|---|---|
| PubChem CID | 162298741 |
| Molecular Formula | C32H53Br |
| Molecular Weight | 517.68 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | 26-bromo-2,6,10,15,19,23-hexamethylhexacosa-2,6,10,14,18,22-hexaene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC=C(C)CCC=C(C)CCC=C(C)CCCBr |
| InChI | InChI=1S/C32H53Br/c1-27(2)15-10-18-30(5)21-11-19-28(3)16-8-9-17-29(4)20-12-22-31(6)23-13-24-32(7)25-14-26-33/h15-17,21-22,24H,8-14,18-20,23,25-26H2,1-7H3 |
| InChIKey | NPLRPDOKUPIUOD-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.68 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|