C14H23Br — CID 86044295
1-bromo-2,6,10-trimethylundeca-1,5,9-triene (PubChem CID 86044295) has the molecular formula C14H23Br and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-bromo-2,6,10-trimethylundeca-1,5,9-triene.
| Compound Name | 1-bromo-2,6,10-trimethylundeca-1,5,9-triene |
|---|---|
| PubChem CID | 86044295 |
| Molecular Formula | C14H23Br |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-bromo-2,6,10-trimethylundeca-1,5,9-triene |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CBr |
| InChI | InChI=1S/C14H23Br/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h7,9,11H,5-6,8,10H2,1-4H3 |
| InChIKey | FAIWJFNBHVNVRL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|