C20H33I — CID 175339928
(2E,10E)-1-iodo-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene (PubChem CID 175339928) has the molecular formula C20H33I and a molecular weight of 400.39 g/mol. Its IUPAC name is (2E,10E)-1-iodo-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene.
| Compound Name | (2E,10E)-1-iodo-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 175339928 |
| Molecular Formula | C20H33I |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (2E,10E)-1-iodo-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)=CCC/C(C)=C/CI |
| InChI | InChI=1S/C20H33I/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13?,20-15+ |
| InChIKey | MMDOUKMWOVPCSO-DYCNYEKWSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|