C34H56BrNO — CID 53468174
2-bromo-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]acetamide (PubChem CID 53468174) has the molecular formula C34H56BrNO and a molecular weight of 574.73 g/mol. Its IUPAC name is 2-bromo-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]acetamide.
| Compound Name | 2-bromo-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]acetamide |
|---|---|
| PubChem CID | 53468174 |
| Molecular Formula | C34H56BrNO |
| Molecular Weight | 574.73 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | 2-bromo-N-[(4E,8E,12E,16E,20E)-4,8,12,17,21,25-hexamethylhexacosa-4,8,12,16,20,24-hexaenyl]acetamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCCNC(=O)CBr |
| InChI | InChI=1S/C34H56BrNO/c1-28(2)15-10-18-31(5)21-11-19-29(3)16-8-9-17-30(4)20-12-22-32(6)23-13-24-33(7)25-14-26-36-34(37)27-35/h15-17,21-22,24H,8-14,18-20,23,25-27H2,1-7H3,(H,36,37)/b29-16+,30-17+,31-21+,32-22+,33-24+ |
| InChIKey | CUCXSEVZLDDCIH-CEHJTYBQSA-N |
| XLogP | 10.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.73 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|