C19H34N2O3 — CID 139608124
2-[3-(5,9-dimethyldeca-4,8-dienoylamino)propyl-dimethylazaniumyl]acetate (PubChem CID 139608124) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is 2-[3-(5,9-dimethyldeca-4,8-dienoylamino)propyl-dimethylazaniumyl]acetate.
| Compound Name | 2-[3-(5,9-dimethyldeca-4,8-dienoylamino)propyl-dimethylazaniumyl]acetate |
|---|---|
| PubChem CID | 139608124 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 2-[3-(5,9-dimethyldeca-4,8-dienoylamino)propyl-dimethylazaniumyl]acetate |
| SMILES | CC(C)=CCCC(C)=CCCC(=O)NCCC[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C19H34N2O3/c1-16(2)9-6-10-17(3)11-7-12-18(22)20-13-8-14-21(4,5)15-19(23)24/h9,11H,6-8,10,12-15H2,1-5H3,(H-,20,22,23,24) |
| InChIKey | LSCSEIQMVMDXOQ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|