C17H33FN2O3 — CID 177439210
2-[3-(6-fluorodecanoylamino)propyl-dimethylazaniumyl]acetate (PubChem CID 177439210) has the molecular formula C17H33FN2O3 and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-[3-(6-fluorodecanoylamino)propyl-dimethylazaniumyl]acetate.
| Compound Name | 2-[3-(6-fluorodecanoylamino)propyl-dimethylazaniumyl]acetate |
|---|---|
| PubChem CID | 177439210 |
| Molecular Formula | C17H33FN2O3 |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 2-[3-(6-fluorodecanoylamino)propyl-dimethylazaniumyl]acetate |
| SMILES | CCCCC(F)CCCCC(=O)NCCC[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C17H33FN2O3/c1-4-5-9-15(18)10-6-7-11-16(21)19-12-8-13-20(2,3)14-17(22)23/h15H,4-14H2,1-3H3,(H-,19,21,22,23) |
| InChIKey | PDOZGYBQWPDYDJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|