C21H37NO2 — CID 123204068
3,7,11-trimethyldodeca-2,6,10-trienyl N-pentylcarbamate (PubChem CID 123204068) has the molecular formula C21H37NO2 and a molecular weight of 335.53 g/mol. Its IUPAC name is 3,7,11-trimethyldodeca-2,6,10-trienyl N-pentylcarbamate.
| Compound Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-pentylcarbamate |
|---|---|
| PubChem CID | 123204068 |
| Molecular Formula | C21H37NO2 |
| Molecular Weight | 335.53 g/mol |
| Exact Mass | 335.28 |
| IUPAC Name | 3,7,11-trimethyldodeca-2,6,10-trienyl N-pentylcarbamate |
| SMILES | CCCCCNC(=O)OCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C21H37NO2/c1-6-7-8-16-22-21(23)24-17-15-20(5)14-10-13-19(4)12-9-11-18(2)3/h11,13,15H,6-10,12,14,16-17H2,1-5H3,(H,22,23) |
| InChIKey | BTGSOPBNZOHNLW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|