C22H36F2N2O4 — CID 72958397
2-amino-2-(difluoromethyl)-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonylamino)pentanoic acid (PubChem CID 72958397) has the molecular formula C22H36F2N2O4 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-amino-2-(difluoromethyl)-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonylamino)pentanoic acid.
| Compound Name | 2-amino-2-(difluoromethyl)-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 72958397 |
| Molecular Formula | C22H36F2N2O4 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 2-amino-2-(difluoromethyl)-5-(3,7,11-trimethyldodeca-2,6,10-trienoxycarbonylamino)pentanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC(=O)NCCCC(N)(C(=O)O)C(F)F |
| InChI | InChI=1S/C22H36F2N2O4/c1-16(2)8-5-9-17(3)10-6-11-18(4)12-15-30-21(29)26-14-7-13-22(25,19(23)24)20(27)28/h8,10,12,19H,5-7,9,11,13-15,25H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | YHZKMIRIHCINML-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|