C14H24F2N2O6 — CID 122624779
2-amino-2-(difluoromethyl)-5-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]pentanoic acid (PubChem CID 122624779) has the molecular formula C14H24F2N2O6 and a molecular weight of 354.35 g/mol. Its IUPAC name is 2-amino-2-(difluoromethyl)-5-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]pentanoic acid.
| Compound Name | 2-amino-2-(difluoromethyl)-5-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 122624779 |
| Molecular Formula | C14H24F2N2O6 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-amino-2-(difluoromethyl)-5-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]pentanoic acid |
| SMILES | CC(OC(=O)NCCCC(N)(C(=O)O)C(F)F)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H24F2N2O6/c1-8(23-11(21)13(2,3)4)24-12(22)18-7-5-6-14(17,9(15)16)10(19)20/h8-9H,5-7,17H2,1-4H3,(H,18,22)(H,19,20) |
| InChIKey | MKNLMKCPVHWYLY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|