C15H28NO7P — CID 87459395
butyl-[3-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]-2-oxopropyl]phosphinic acid (PubChem CID 87459395) has the molecular formula C15H28NO7P and a molecular weight of 365.36 g/mol. Its IUPAC name is butyl-[3-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]-2-oxopropyl]phosphinic acid.
| Compound Name | butyl-[3-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]-2-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 87459395 |
| Molecular Formula | C15H28NO7P |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | butyl-[3-[1-(2,2-dimethylpropanoyloxy)ethoxycarbonylamino]-2-oxopropyl]phosphinic acid |
| SMILES | CCCCP(=O)(O)CC(=O)CNC(=O)OC(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H28NO7P/c1-6-7-8-24(20,21)10-12(17)9-16-14(19)23-11(2)22-13(18)15(3,4)5/h11H,6-10H2,1-5H3,(H,16,19)(H,20,21) |
| InChIKey | UBXHSBSMDLSBDR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|