C15H30O2 — CID 140617078
2-methylnonan-4-yl 2,2-dimethylpropanoate (PubChem CID 140617078) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 2-methylnonan-4-yl 2,2-dimethylpropanoate.
| Compound Name | 2-methylnonan-4-yl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 140617078 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2-methylnonan-4-yl 2,2-dimethylpropanoate |
| SMILES | CCCCCC(CC(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H30O2/c1-7-8-9-10-13(11-12(2)3)17-14(16)15(4,5)6/h12-13H,7-11H2,1-6H3 |
| InChIKey | MQJCGCHAVFJLPC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|