About 2-methyltridecan-4-yl dihydrogen phosphite
2-methyltridecan-4-yl dihydrogen phosphite (PubChem CID 154375180) has the molecular formula C14H31O3P
and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-methyltridecan-4-yl dihydrogen phosphite.
Molecular Properties
| Compound Name | 2-methyltridecan-4-yl dihydrogen phosphite |
| PubChem CID | 154375180 |
| Molecular Formula | C14H31O3P |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-methyltridecan-4-yl dihydrogen phosphite |
| SMILES | CCCCCCCCCC(CC(C)C)OP(O)O |
| InChI | InChI=1S/C14H31O3P/c1-4-5-6-7-8-9-10-11-14(12-13(2)3)17-18(15)16/h13-16H,4-12H2,1-3H3 |
| InChIKey | LIARFQDGDDXNFW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methyltridecan-4-yl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyltridecan-4-yl dihydrogen phosphite?
The IUPAC name of 2-methyltridecan-4-yl dihydrogen phosphite (CID 154375180) is 2-methyltridecan-4-yl dihydrogen phosphite.
What is the SMILES notation for 2-methyltridecan-4-yl dihydrogen phosphite?
The canonical SMILES for 2-methyltridecan-4-yl dihydrogen phosphite is CCCCCCCCCC(CC(C)C)OP(O)O.
What is the InChIKey of 2-methyltridecan-4-yl dihydrogen phosphite?
The InChIKey is LIARFQDGDDXNFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31O3P/c1-4-5-6-7-8-9-10-11-14(12-13(2)3)17-18(15)16/h13-16H,4-12H2,1-3H3.
What are the key properties of 2-methyltridecan-4-yl dihydrogen phosphite?
2-methyltridecan-4-yl dihydrogen phosphite has a molecular weight of 278.37 g/mol, XLogP of 4.77, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyltridecan-4-yl dihydrogen phosphite is sourced from PubChem (CID 154375180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).