About octadecan-3-yl dihydrogen phosphite
octadecan-3-yl dihydrogen phosphite (PubChem CID 87219240) has the molecular formula C18H39O3P
and a molecular weight of 334.48 g/mol. Its IUPAC name is octadecan-3-yl dihydrogen phosphite.
Molecular Properties
| Compound Name | octadecan-3-yl dihydrogen phosphite |
| PubChem CID | 87219240 |
| Molecular Formula | C18H39O3P |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.26 |
| IUPAC Name | octadecan-3-yl dihydrogen phosphite |
| SMILES | CCCCCCCCCCCCCCCC(CC)OP(O)O |
| InChI | InChI=1S/C18H39O3P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(4-2)21-22(19)20/h18-20H,3-17H2,1-2H3 |
| InChIKey | APHYTQMIMPZJLQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze octadecan-3-yl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecan-3-yl dihydrogen phosphite?
The IUPAC name of octadecan-3-yl dihydrogen phosphite (CID 87219240) is octadecan-3-yl dihydrogen phosphite.
What is the SMILES notation for octadecan-3-yl dihydrogen phosphite?
The canonical SMILES for octadecan-3-yl dihydrogen phosphite is CCCCCCCCCCCCCCCC(CC)OP(O)O.
What is the InChIKey of octadecan-3-yl dihydrogen phosphite?
The InChIKey is APHYTQMIMPZJLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39O3P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(4-2)21-22(19)20/h18-20H,3-17H2,1-2H3.
What are the key properties of octadecan-3-yl dihydrogen phosphite?
octadecan-3-yl dihydrogen phosphite has a molecular weight of 334.48 g/mol, XLogP of 6.47, 17 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadecan-3-yl dihydrogen phosphite is sourced from PubChem (CID 87219240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).