C13H24NO7P — CID 87306600
methyl-[3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]-2-oxopropyl]phosphinic acid (PubChem CID 87306600) has the molecular formula C13H24NO7P and a molecular weight of 337.31 g/mol. Its IUPAC name is methyl-[3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]-2-oxopropyl]phosphinic acid.
| Compound Name | methyl-[3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]-2-oxopropyl]phosphinic acid |
|---|---|
| PubChem CID | 87306600 |
| Molecular Formula | C13H24NO7P |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl-[3-[[(1S)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]-2-oxopropyl]phosphinic acid |
| SMILES | CC(C)C(=O)O[C@@H](OC(=O)NCC(=O)CP(C)(=O)O)C(C)C |
| InChI | InChI=1S/C13H24NO7P/c1-8(2)11(16)20-12(9(3)4)21-13(17)14-6-10(15)7-22(5,18)19/h8-9,12H,6-7H2,1-5H3,(H,14,17)(H,18,19)/t12-/m0/s1 |
| InChIKey | QNPKEKIZAWUXEE-LBPRGKRZSA-N |
| XLogP | 1.36 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|