C12H23FNO6P — CID 91366533
[(2R)-2-fluoro-3-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propyl]phosphonous acid (PubChem CID 91366533) has the molecular formula C12H23FNO6P and a molecular weight of 327.29 g/mol. Its IUPAC name is [(2R)-2-fluoro-3-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propyl]phosphonous acid.
| Compound Name | [(2R)-2-fluoro-3-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propyl]phosphonous acid |
|---|---|
| PubChem CID | 91366533 |
| Molecular Formula | C12H23FNO6P |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | [(2R)-2-fluoro-3-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]propyl]phosphonous acid |
| SMILES | CC(C)C(=O)O[C@H](OC(=O)NC[C@@H](F)CP(O)O)C(C)C |
| InChI | InChI=1S/C12H23FNO6P/c1-7(2)10(15)19-11(8(3)4)20-12(16)14-5-9(13)6-21(17)18/h7-9,11,17-18H,5-6H2,1-4H3,(H,14,16)/t9-,11-/m1/s1 |
| InChIKey | MHGOZPBNRGSQFM-MWLCHTKSSA-N |
| XLogP | 1.53 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|