C19H25ClNNaO6 — CID 23701727
sodium 2-(4-chlorophenyl)-4-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoate (PubChem CID 23701727) has the molecular formula C19H25ClNNaO6 and a molecular weight of 421.85 g/mol. Its IUPAC name is sodium 2-(4-chlorophenyl)-4-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoate.
| Compound Name | sodium 2-(4-chlorophenyl)-4-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoate |
|---|---|
| PubChem CID | 23701727 |
| Molecular Formula | C19H25ClNNaO6 |
| Molecular Weight | 421.85 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | sodium 2-(4-chlorophenyl)-4-[[(1R)-2-methyl-1-(2-methylpropanoyloxy)propoxy]carbonylamino]butanoate |
| SMILES | CC(C)C(=O)O[C@H](OC(=O)NCCC(C(=O)[O-])c1ccc(Cl)cc1)C(C)C.[Na+] |
| InChI | InChI=1S/C19H26ClNO6.Na/c1-11(2)17(24)26-18(12(3)4)27-19(25)21-10-9-15(16(22)23)13-5-7-14(20)8-6-13;/h5-8,11-12,15,18H,9-10H2,1-4H3,(H,21,25)(H,22,23);/q;+1/p-1/t15?,18-;/m1./s1 |
| InChIKey | WYPJHKIIXXSIPS-RUMBQWAVSA-M |
| XLogP | -0.52 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.85 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|