C17H22ClNO6 — CID 66662741
(3R)-3-(4-chlorophenyl)-4-[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]butanoic acid (PubChem CID 66662741) has the molecular formula C17H22ClNO6 and a molecular weight of 371.82 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-4-[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]butanoic acid.
| Compound Name | (3R)-3-(4-chlorophenyl)-4-[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]butanoic acid |
|---|---|
| PubChem CID | 66662741 |
| Molecular Formula | C17H22ClNO6 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-4-[[(1S)-1-(2-methylpropanoyloxy)ethoxy]carbonylamino]butanoic acid |
| SMILES | CC(C)C(=O)O[C@H](C)OC(=O)NC[C@H](CC(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H22ClNO6/c1-10(2)16(22)24-11(3)25-17(23)19-9-13(8-15(20)21)12-4-6-14(18)7-5-12/h4-7,10-11,13H,8-9H2,1-3H3,(H,19,23)(H,20,21)/t11-,13-/m0/s1 |
| InChIKey | YUAXWPUEMMLXAN-AAEUAGOBSA-N |
| XLogP | 3.17 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|